C15H16N2O3 — CID 61459502
N-(1,3-benzodioxol-5-yl)-1-cyanocyclohexane-1-carboxamide (PubChem CID 61459502) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-cyanocyclohexane-1-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-cyanocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 61459502 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-cyanocyclohexane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc3c(c2)OCO3)CCCCC1 |
| InChI | InChI=1S/C15H16N2O3/c16-9-15(6-2-1-3-7-15)14(18)17-11-4-5-12-13(8-11)20-10-19-12/h4-5,8H,1-3,6-7,10H2,(H,17,18) |
| InChIKey | VDHQRSAGMPXLMA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |