C24H24N2O6 — CID 4537265
N-(1,3-benzodioxol-5-yl)-1-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]cyclohexane-1-carboxamide (PubChem CID 4537265) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]cyclohexane-1-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4537265 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]cyclohexane-1-carboxamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NC1(C(=O)Nc2ccc3c(c2)OCO3)CCCCC1 |
| InChI | InChI=1S/C24H24N2O6/c27-22(9-5-16-4-7-18-20(12-16)31-14-29-18)26-24(10-2-1-3-11-24)23(28)25-17-6-8-19-21(13-17)32-15-30-19/h4-9,12-13H,1-3,10-11,14-15H2,(H,25,28)(H,26,27) |
| InChIKey | YZMBHOUCIHJVLT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|