C18H21NO5 — CID 91941989
1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]cyclohexane-1-carboxylic acid (PubChem CID 91941989) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 91941989 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc2c(c1)OCCO2)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H21NO5/c20-16(19-18(17(21)22)8-2-1-3-9-18)7-5-13-4-6-14-15(12-13)24-11-10-23-14/h4-7,12H,1-3,8-11H2,(H,19,20)(H,21,22) |
| InChIKey | DYZUQMFDTNPJFO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|