C15H17NO3 — CID 25151508
(E)-1-(1-aminocyclopentyl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 25151508) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (E)-1-(1-aminocyclopentyl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(1-aminocyclopentyl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 25151508 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (E)-1-(1-aminocyclopentyl)-3-(1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | NC1(C(=O)/C=C/c2ccc3c(c2)OCO3)CCCC1 |
| InChI | InChI=1S/C15H17NO3/c16-15(7-1-2-8-15)14(17)6-4-11-3-5-12-13(9-11)19-10-18-12/h3-6,9H,1-2,7-8,10,16H2/b6-4+ |
| InChIKey | LDHXFMFMVGJBNN-GQCTYLIASA-N |
| XLogP | 2.27 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|