C12H10F2N2OS — CID 80598971
1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 80598971) has the molecular formula C12H10F2N2OS and a molecular weight of 268.29 g/mol. Its IUPAC name is 1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80598971 |
| Molecular Formula | C12H10F2N2OS |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C12H10F2N2OS/c13-11(14)18-9-3-1-8(2-4-9)16-10(17)12(7-15)5-6-12/h1-4,11H,5-6H2,(H,16,17) |
| InChIKey | IGDDELAQEKDLET-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |