C12H14F2N2O2 — CID 90093326
2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylic acid (PubChem CID 90093326) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 90093326 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H14F2N2O2/c13-12(14)5-3-8(4-6-12)16-10-9(11(17)18)2-1-7-15-10/h1-2,7-8H,3-6H2,(H,15,16)(H,17,18) |
| InChIKey | CZOUBCQRJBHQPL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |