C13H16F2N2O2 — CID 90092997
methyl 2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylate (PubChem CID 90092997) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90092997 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | methyl 2-[(4,4-difluorocyclohexyl)amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-19-12(18)10-3-2-8-16-11(10)17-9-4-6-13(14,15)7-5-9/h2-3,8-9H,4-7H2,1H3,(H,16,17) |
| InChIKey | QYWRUSOKHCRTJJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |