C17H23F2N5O — CID 169204919
1-[4-[3-[(4,4-difluorocyclohexyl)amino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 169204919) has the molecular formula C17H23F2N5O and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-[4-[3-[(4,4-difluorocyclohexyl)amino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[(4,4-difluorocyclohexyl)amino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169204919 |
| Molecular Formula | C17H23F2N5O |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[4-[3-[(4,4-difluorocyclohexyl)amino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nccnc2NC2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C17H23F2N5O/c1-2-14(25)23-9-11-24(12-10-23)16-15(20-7-8-21-16)22-13-3-5-17(18,19)6-4-13/h2,7-8,13H,1,3-6,9-12H2,(H,20,22) |
| InChIKey | CBYYTZVUVHWDSW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|