C20H25F2N5O2 — CID 169204987
1-[4-[3-[4-(1,1-difluoroprop-2-enyl)piperidine-1-carbonyl]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 169204987) has the molecular formula C20H25F2N5O2 and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-[4-[3-[4-(1,1-difluoroprop-2-enyl)piperidine-1-carbonyl]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[4-(1,1-difluoroprop-2-enyl)piperidine-1-carbonyl]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169204987 |
| Molecular Formula | C20H25F2N5O2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[4-[3-[4-(1,1-difluoroprop-2-enyl)piperidine-1-carbonyl]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nccnc2C(=O)N2CCC(C(F)(F)C=C)CC2)CC1 |
| InChI | InChI=1S/C20H25F2N5O2/c1-3-16(28)25-11-13-26(14-12-25)18-17(23-7-8-24-18)19(29)27-9-5-15(6-10-27)20(21,22)4-2/h3-4,7-8,15H,1-2,5-6,9-14H2 |
| InChIKey | APARSHDMADUKCB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|