C22H22F5N5O — CID 146380172
1-[4-[(7R)-7-[3-amino-2,5-difluoro-6-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 146380172) has the molecular formula C22H22F5N5O and a molecular weight of 467.44 g/mol. Its IUPAC name is 1-[4-[(7R)-7-[3-amino-2,5-difluoro-6-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[(7R)-7-[3-amino-2,5-difluoro-6-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146380172 |
| Molecular Formula | C22H22F5N5O |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-[4-[(7R)-7-[3-amino-2,5-difluoro-6-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c2CC[C@@H](c2c(F)c(N)cc(F)c2C(F)(F)F)C3)CC1 |
| InChI | InChI=1S/C22H22F5N5O/c1-2-17(33)31-5-7-32(8-6-31)21-13-4-3-12(9-16(13)29-11-30-21)18-19(22(25,26)27)14(23)10-15(28)20(18)24/h2,10-12H,1,3-9,28H2/t12-/m1/s1 |
| InChIKey | KSAHSTDIFNLHMB-GFCCVEGCSA-N |
| XLogP | 3.46 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|