C24H28N6O — CID 146389592
1-[4-[7-(5,6-dimethyl-1H-benzimidazol-4-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 146389592) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-[4-[7-(5,6-dimethyl-1H-benzimidazol-4-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-(5,6-dimethyl-1H-benzimidazol-4-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146389592 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-[4-[7-(5,6-dimethyl-1H-benzimidazol-4-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c2CCC(c2c(C)c(C)cc4[nH]cnc24)C3)CC1 |
| InChI | InChI=1S/C24H28N6O/c1-4-21(31)29-7-9-30(10-8-29)24-18-6-5-17(12-19(18)25-14-28-24)22-16(3)15(2)11-20-23(22)27-13-26-20/h4,11,13-14,17H,1,5-10,12H2,2-3H3,(H,26,27) |
| InChIKey | SDHOFLBYLQEONV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|