C26H36N6O — CID 153334181
ethane;5-methyl-1H-indazole;1-[4-(6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 153334181) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is ethane;5-methyl-1H-indazole;1-[4-(6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | ethane;5-methyl-1H-indazole;1-[4-(6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 153334181 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | ethane;5-methyl-1H-indazole;1-[4-(6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c2CC(C)CC3)CC1.CC.Cc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C16H22N4O.C8H8N2.C2H6/c1-3-15(21)19-6-8-20(9-7-19)16-13-10-12(2)4-5-14(13)17-11-18-16;1-6-2-3-8-7(4-6)5-9-10-8;1-2/h3,11-12H,1,4-10H2,2H3;2-5H,1H3,(H,9,10);1-2H3 |
| InChIKey | DYESGFMICPYXQE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|