C23H20Cl2N6O — CID 134471677
1-[4-[6,8-dichloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 134471677) has the molecular formula C23H20Cl2N6O and a molecular weight of 467.36 g/mol. Its IUPAC name is 1-[4-[6,8-dichloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[6,8-dichloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134471677 |
| Molecular Formula | C23H20Cl2N6O |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 1-[4-[6,8-dichloro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(Cl)c(-c4c(C)ccc5[nH]ncc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C23H20Cl2N6O/c1-3-18(32)30-6-8-31(9-7-30)23-14-10-16(24)20(21(25)22(14)26-12-27-23)19-13(2)4-5-17-15(19)11-28-29-17/h3-5,10-12H,1,6-9H2,2H3,(H,28,29) |
| InChIKey | JCWXWNLFNPFWRN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|