C26H32F2N8O — CID 146281678
N-[2-[[5-cyano-4-[(4,4-difluorocyclohexyl)amino]pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 146281678) has the molecular formula C26H32F2N8O and a molecular weight of 510.59 g/mol. Its IUPAC name is N-[2-[[5-cyano-4-[(4,4-difluorocyclohexyl)amino]pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-cyano-4-[(4,4-difluorocyclohexyl)amino]pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146281678 |
| Molecular Formula | C26H32F2N8O |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | N-[2-[[5-cyano-4-[(4,4-difluorocyclohexyl)amino]pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1Nc1ncc(C#N)c(NC2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C26H32F2N8O/c1-3-23(37)32-22-15-20(36-13-11-35(4-2)12-14-36)5-6-21(22)33-25-30-17-18(16-29)24(34-25)31-19-7-9-26(27,28)10-8-19/h3,5-6,15,17,19H,1,4,7-14H2,2H3,(H,32,37)(H2,30,31,33,34) |
| InChIKey | JXCUUDMKFQHUET-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|