C30H33N9O2 — CID 156562115
N-[2-[[5-cyano-4-(4-cyano-2-propan-2-yloxyanilino)pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 156562115) has the molecular formula C30H33N9O2 and a molecular weight of 551.66 g/mol. Its IUPAC name is N-[2-[[5-cyano-4-(4-cyano-2-propan-2-yloxyanilino)pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-cyano-4-(4-cyano-2-propan-2-yloxyanilino)pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156562115 |
| Molecular Formula | C30H33N9O2 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-[2-[[5-cyano-4-(4-cyano-2-propan-2-yloxyanilino)pyrimidin-2-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1Nc1ncc(C#N)c(Nc2ccc(C#N)cc2OC(C)C)n1 |
| InChI | InChI=1S/C30H33N9O2/c1-5-28(40)34-26-16-23(39-13-11-38(6-2)12-14-39)8-10-24(26)36-30-33-19-22(18-32)29(37-30)35-25-9-7-21(17-31)15-27(25)41-20(3)4/h5,7-10,15-16,19-20H,1,6,11-14H2,2-4H3,(H,34,40)(H2,33,35,36,37) |
| InChIKey | NCXABAMCMIMAMJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|