C28H31N9O3 — CID 175105769
N-[2-[amino-[5-cyano-4-[(4-nitrophenyl)methylamino]-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 175105769) has the molecular formula C28H31N9O3 and a molecular weight of 541.62 g/mol. Its IUPAC name is N-[2-[amino-[5-cyano-4-[(4-nitrophenyl)methylamino]-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[amino-[5-cyano-4-[(4-nitrophenyl)methylamino]-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175105769 |
| Molecular Formula | C28H31N9O3 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | N-[2-[amino-[5-cyano-4-[(4-nitrophenyl)methylamino]-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1N(N)c1cc(NCc2ccc([N+](=O)[O-])cc2)c(C#N)cn1 |
| InChI | InChI=1S/C28H31N9O3/c1-3-28(38)33-25-15-23(35-13-11-34(4-2)12-14-35)9-10-26(25)36(30)27-16-24(21(17-29)19-32-27)31-18-20-5-7-22(8-6-20)37(39)40/h3,5-10,15-16,19H,1,4,11-14,18,30H2,2H3,(H,31,32)(H,33,38) |
| InChIKey | JPVHPEXORSPGGY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|