C24H30N8O — CID 146281796
N-[5-[[5-cyano-4-(cyclobutylamino)-2-pyridinyl]amino]-2-(4-ethylpiperazin-1-yl)-4-pyridinyl]prop-2-enamide (PubChem CID 146281796) has the molecular formula C24H30N8O and a molecular weight of 446.56 g/mol. Its IUPAC name is N-[5-[[5-cyano-4-(cyclobutylamino)-2-pyridinyl]amino]-2-(4-ethylpiperazin-1-yl)-4-pyridinyl]prop-2-enamide.
| Compound Name | N-[5-[[5-cyano-4-(cyclobutylamino)-2-pyridinyl]amino]-2-(4-ethylpiperazin-1-yl)-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 146281796 |
| Molecular Formula | C24H30N8O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | N-[5-[[5-cyano-4-(cyclobutylamino)-2-pyridinyl]amino]-2-(4-ethylpiperazin-1-yl)-4-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ncc1Nc1cc(NC2CCC2)c(C#N)cn1 |
| InChI | InChI=1S/C24H30N8O/c1-3-24(33)30-20-13-23(32-10-8-31(4-2)9-11-32)27-16-21(20)29-22-12-19(17(14-25)15-26-22)28-18-6-5-7-18/h3,12-13,15-16,18H,1,4-11H2,2H3,(H2,26,28,29)(H,27,30,33) |
| InChIKey | CXYSZTMJLAJJSK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|