C30H35N9O2 — CID 146281679
4-[[5-cyano-2-[4-(4-ethylpiperazin-1-yl)-2-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzamide (PubChem CID 146281679) has the molecular formula C30H35N9O2 and a molecular weight of 553.67 g/mol. Its IUPAC name is 4-[[5-cyano-2-[4-(4-ethylpiperazin-1-yl)-2-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 4-[[5-cyano-2-[4-(4-ethylpiperazin-1-yl)-2-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 146281679 |
| Molecular Formula | C30H35N9O2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 4-[[5-cyano-2-[4-(4-ethylpiperazin-1-yl)-2-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]-N-propan-2-ylbenzamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1Nc1ncc(C#N)c(Nc2ccc(C(=O)NC(C)C)cc2)n1 |
| InChI | InChI=1S/C30H35N9O2/c1-5-27(40)35-26-17-24(39-15-13-38(6-2)14-16-39)11-12-25(26)36-30-32-19-22(18-31)28(37-30)34-23-9-7-21(8-10-23)29(41)33-20(3)4/h5,7-12,17,19-20H,1,6,13-16H2,2-4H3,(H,33,41)(H,35,40)(H2,32,34,36,37) |
| InChIKey | YNQYQKYGFXEKHW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|