C26H33N7O2 — CID 146281670
N-[2-[[5-cyano-4-(oxan-4-ylamino)-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 146281670) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[2-[[5-cyano-4-(oxan-4-ylamino)-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-cyano-4-(oxan-4-ylamino)-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146281670 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-[2-[[5-cyano-4-(oxan-4-ylamino)-2-pyridinyl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1Nc1cc(NC2CCOCC2)c(C#N)cn1 |
| InChI | InChI=1S/C26H33N7O2/c1-3-26(34)31-24-15-21(33-11-9-32(4-2)10-12-33)5-6-22(24)30-25-16-23(19(17-27)18-28-25)29-20-7-13-35-14-8-20/h3,5-6,15-16,18,20H,1,4,7-14H2,2H3,(H,31,34)(H2,28,29,30) |
| InChIKey | IHYICWUKXUTISP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|