C27H31N9O2 — CID 175097594
N-[2-[2-[5-cyano-4-[(3-methoxy-2-pyridinyl)amino]-2-pyridinyl]hydrazinyl]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 175097594) has the molecular formula C27H31N9O2 and a molecular weight of 513.61 g/mol. Its IUPAC name is N-[2-[2-[5-cyano-4-[(3-methoxy-2-pyridinyl)amino]-2-pyridinyl]hydrazinyl]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-[5-cyano-4-[(3-methoxy-2-pyridinyl)amino]-2-pyridinyl]hydrazinyl]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175097594 |
| Molecular Formula | C27H31N9O2 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | N-[2-[2-[5-cyano-4-[(3-methoxy-2-pyridinyl)amino]-2-pyridinyl]hydrazinyl]-5-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1NNc1cc(Nc2ncccc2OC)c(C#N)cn1 |
| InChI | InChI=1S/C27H31N9O2/c1-4-26(37)31-23-15-20(36-13-11-35(5-2)12-14-36)8-9-21(23)33-34-25-16-22(19(17-28)18-30-25)32-27-24(38-3)7-6-10-29-27/h4,6-10,15-16,18,33H,1,5,11-14H2,2-3H3,(H,31,37)(H2,29,30,32,34) |
| InChIKey | WVAKUZAPDARCJO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|