C28H33N6O3P — CID 122498916
N-[5-[[5-cyano-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methyl-2-pentan-3-yloxyphenyl]prop-2-enamide (PubChem CID 122498916) has the molecular formula C28H33N6O3P and a molecular weight of 532.59 g/mol. Its IUPAC name is N-[5-[[5-cyano-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methyl-2-pentan-3-yloxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-cyano-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methyl-2-pentan-3-yloxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122498916 |
| Molecular Formula | C28H33N6O3P |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | N-[5-[[5-cyano-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methyl-2-pentan-3-yloxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(C#N)c(Nc3ccccc3P(C)(C)=O)n2)c(C)cc1OC(CC)CC |
| InChI | InChI=1S/C28H33N6O3P/c1-7-20(8-2)37-24-14-18(4)22(15-23(24)31-26(35)9-3)33-28-30-17-19(16-29)27(34-28)32-21-12-10-11-13-25(21)38(5,6)36/h9-15,17,20H,3,7-8H2,1-2,4-6H3,(H,31,35)(H2,30,32,33,34) |
| InChIKey | IZUIPVPNJNAGIE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|