C13H18N2O — CID 89458374
N-(3-tert-butyl-2-pyridinyl)cyclopropanecarboxamide (PubChem CID 89458374) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-(3-tert-butyl-2-pyridinyl)cyclopropanecarboxamide.
| Compound Name | N-(3-tert-butyl-2-pyridinyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 89458374 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-(3-tert-butyl-2-pyridinyl)cyclopropanecarboxamide |
| SMILES | CC(C)(C)c1cccnc1NC(=O)C1CC1 |
| InChI | InChI=1S/C13H18N2O/c1-13(2,3)10-5-4-8-14-11(10)15-12(16)9-6-7-9/h4-5,8-9H,6-7H2,1-3H3,(H,14,15,16) |
| InChIKey | LJNFRTZGPUGMAO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |