C10H13F2N3OS — CID 175864492
5-[(4,4-difluorocyclohexyl)methyl]thiadiazole-4-carboxamide (PubChem CID 175864492) has the molecular formula C10H13F2N3OS and a molecular weight of 261.30 g/mol. Its IUPAC name is 5-[(4,4-difluorocyclohexyl)methyl]thiadiazole-4-carboxamide.
| Compound Name | 5-[(4,4-difluorocyclohexyl)methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 175864492 |
| Molecular Formula | C10H13F2N3OS |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-[(4,4-difluorocyclohexyl)methyl]thiadiazole-4-carboxamide |
| SMILES | NC(=O)c1nnsc1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H13F2N3OS/c11-10(12)3-1-6(2-4-10)5-7-8(9(13)16)14-15-17-7/h6H,1-5H2,(H2,13,16) |
| InChIKey | HASMGNLQHMNLHE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |