C21H23F2NO — CID 58276647
3-[4-[2-(4,4-difluorocyclohexyl)ethyl]phenyl]benzamide (PubChem CID 58276647) has the molecular formula C21H23F2NO and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-[4-[2-(4,4-difluorocyclohexyl)ethyl]phenyl]benzamide.
| Compound Name | 3-[4-[2-(4,4-difluorocyclohexyl)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58276647 |
| Molecular Formula | C21H23F2NO |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 3-[4-[2-(4,4-difluorocyclohexyl)ethyl]phenyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(CCC3CCC(F)(F)CC3)cc2)c1 |
| InChI | InChI=1S/C21H23F2NO/c22-21(23)12-10-16(11-13-21)5-4-15-6-8-17(9-7-15)18-2-1-3-19(14-18)20(24)25/h1-3,6-9,14,16H,4-5,10-13H2,(H2,24,25) |
| InChIKey | OYYQLNPMZYZFIU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |