About 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide
3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide (PubChem CID 58276428) has the molecular formula C24H22FNO
and a molecular weight of 359.44 g/mol. Its IUPAC name is 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide.
Molecular Properties
| Compound Name | 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide |
| PubChem CID | 58276428 |
| Molecular Formula | C24H22FNO |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(CCC3Cc4ccc(F)cc4C3)cc2)c1 |
| InChI | InChI=1S/C24H22FNO/c25-23-11-10-20-12-17(13-22(20)15-23)5-4-16-6-8-18(9-7-16)19-2-1-3-21(14-19)24(26)27/h1-3,6-11,14-15,17H,4-5,12-13H2,(H2,26,27) |
| InChIKey | SPTRQHMOVAMGAQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide?
The IUPAC name of 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide (CID 58276428) is 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide.
What is the SMILES notation for 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide?
The canonical SMILES for 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide is NC(=O)c1cccc(-c2ccc(CCC3Cc4ccc(F)cc4C3)cc2)c1.
What is the InChIKey of 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide?
The InChIKey is SPTRQHMOVAMGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FNO/c25-23-11-10-20-12-17(13-22(20)15-23)5-4-16-6-8-18(9-7-16)19-2-1-3-21(14-19)24(26)27/h1-3,6-11,14-15,17H,4-5,12-13H2,(H2,26,27).
What are the key properties of 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide?
3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide has a molecular weight of 359.44 g/mol, XLogP of 4.94, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide is sourced from PubChem (CID 58276428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).