C24H22FNO — CID 58276428
3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide (PubChem CID 58276428) has the molecular formula C24H22FNO and a molecular weight of 359.44 g/mol. Its IUPAC name is 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide.
| Compound Name | 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58276428 |
| Molecular Formula | C24H22FNO |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[4-[2-(5-fluoro-2,3-dihydro-1H-inden-2-yl)ethyl]phenyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(CCC3Cc4ccc(F)cc4C3)cc2)c1 |
| InChI | InChI=1S/C24H22FNO/c25-23-11-10-20-12-17(13-22(20)15-23)5-4-16-6-8-18(9-7-16)19-2-1-3-21(14-19)24(26)27/h1-3,6-11,14-15,17H,4-5,12-13H2,(H2,26,27) |
| InChIKey | SPTRQHMOVAMGAQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |