C22H25NO3 — CID 58276758
tert-butyl 2-[5-(3-carbamoylphenyl)-2,3-dihydro-1H-inden-2-yl]acetate (PubChem CID 58276758) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl 2-[5-(3-carbamoylphenyl)-2,3-dihydro-1H-inden-2-yl]acetate.
| Compound Name | tert-butyl 2-[5-(3-carbamoylphenyl)-2,3-dihydro-1H-inden-2-yl]acetate |
|---|---|
| PubChem CID | 58276758 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl 2-[5-(3-carbamoylphenyl)-2,3-dihydro-1H-inden-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1Cc2ccc(-c3cccc(C(N)=O)c3)cc2C1 |
| InChI | InChI=1S/C22H25NO3/c1-22(2,3)26-20(24)11-14-9-16-7-8-17(13-19(16)10-14)15-5-4-6-18(12-15)21(23)25/h4-8,12-14H,9-11H2,1-3H3,(H2,23,25) |
| InChIKey | WMGBWXHQTAWNEJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |