C24H30N2O — CID 58276629
3-[1-[(4,4-dimethylcyclohexyl)amino]-2,3-dihydro-1H-inden-5-yl]benzamide (PubChem CID 58276629) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 3-[1-[(4,4-dimethylcyclohexyl)amino]-2,3-dihydro-1H-inden-5-yl]benzamide.
| Compound Name | 3-[1-[(4,4-dimethylcyclohexyl)amino]-2,3-dihydro-1H-inden-5-yl]benzamide |
|---|---|
| PubChem CID | 58276629 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 3-[1-[(4,4-dimethylcyclohexyl)amino]-2,3-dihydro-1H-inden-5-yl]benzamide |
| SMILES | CC1(C)CCC(NC2CCc3cc(-c4cccc(C(N)=O)c4)ccc32)CC1 |
| InChI | InChI=1S/C24H30N2O/c1-24(2)12-10-20(11-13-24)26-22-9-7-18-14-17(6-8-21(18)22)16-4-3-5-19(15-16)23(25)27/h3-6,8,14-15,20,22,26H,7,9-13H2,1-2H3,(H2,25,27) |
| InChIKey | UUDCWXYQTWJBHP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |