About 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide
2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide (PubChem CID 68603565) has the molecular formula C23H20F2N2O
and a molecular weight of 378.42 g/mol. Its IUPAC name is 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide.
Molecular Properties
| Compound Name | 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide |
| PubChem CID | 68603565 |
| Molecular Formula | C23H20F2N2O |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide |
| SMILES | NC(=O)c1cc(-c2cccc(F)c2)ccc1CN[C@@H]1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C23H20F2N2O/c24-19-3-1-2-14(8-19)16-4-5-17(22(12-16)23(26)28)13-27-21-10-15-6-7-20(25)9-18(15)11-21/h1-9,12,21,27H,10-11,13H2,(H2,26,28)/t21-/m1/s1 |
| InChIKey | MRKCDZNGNXVBBK-OAQYLSRUSA-N |
| XLogP | 3.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide?
The IUPAC name of 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide (CID 68603565) is 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide.
What is the SMILES notation for 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide?
The canonical SMILES for 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide is NC(=O)c1cc(-c2cccc(F)c2)ccc1CN[C@@H]1Cc2ccc(F)cc2C1.
What is the InChIKey of 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide?
The InChIKey is MRKCDZNGNXVBBK-OAQYLSRUSA-N. The full InChI is InChI=1S/C23H20F2N2O/c24-19-3-1-2-14(8-19)16-4-5-17(22(12-16)23(26)28)13-27-21-10-15-6-7-20(25)9-18(15)11-21/h1-9,12,21,27H,10-11,13H2,(H2,26,28)/t21-/m1/s1.
What are the key properties of 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide?
2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide has a molecular weight of 378.42 g/mol, XLogP of 3.99, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]amino]methyl]-5-(3-fluorophenyl)benzamide is sourced from PubChem (CID 68603565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).