About 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride
4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride (PubChem CID 68604408) has the molecular formula C23H22ClFN2O
and a molecular weight of 396.89 g/mol. Its IUPAC name is 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride |
| PubChem CID | 68604408 |
| Molecular Formula | C23H22ClFN2O |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(-c2ccc(F)c(CNC3Cc4ccccc4C3)c2)cc1 |
| InChI | InChI=1S/C23H21FN2O.ClH/c24-22-10-9-19(15-5-7-16(8-6-15)23(25)27)11-20(22)14-26-21-12-17-3-1-2-4-18(17)13-21;/h1-11,21,26H,12-14H2,(H2,25,27);1H |
| InChIKey | YIUCAKXXPOSTAY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride?
The IUPAC name of 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride (CID 68604408) is 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride.
What is the SMILES notation for 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride?
The canonical SMILES for 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride is Cl.NC(=O)c1ccc(-c2ccc(F)c(CNC3Cc4ccccc4C3)c2)cc1.
What is the InChIKey of 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride?
The InChIKey is YIUCAKXXPOSTAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21FN2O.ClH/c24-22-10-9-19(15-5-7-16(8-6-15)23(25)27)11-20(22)14-26-21-12-17-3-1-2-4-18(17)13-21;/h1-11,21,26H,12-14H2,(H2,25,27);1H.
What are the key properties of 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride?
4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride has a molecular weight of 396.89 g/mol, XLogP of 4.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-4-fluorophenyl]benzamide;hydrochloride is sourced from PubChem (CID 68604408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).