C24H29F3N2O3 — CID 68603863
3-[3-[2-(cyclohexylmethylamino)ethyl]phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 68603863) has the molecular formula C24H29F3N2O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-[3-[2-(cyclohexylmethylamino)ethyl]phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-[2-(cyclohexylmethylamino)ethyl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68603863 |
| Molecular Formula | C24H29F3N2O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 3-[3-[2-(cyclohexylmethylamino)ethyl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc(-c2cccc(CCNCC3CCCCC3)c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N2O.C2HF3O2/c23-22(25)21-11-5-10-20(15-21)19-9-4-8-17(14-19)12-13-24-16-18-6-2-1-3-7-18;3-2(4,5)1(6)7/h4-5,8-11,14-15,18,24H,1-3,6-7,12-13,16H2,(H2,23,25);(H,6,7) |
| InChIKey | DBLYDCVJTLVYQS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|