5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid

C8H9F2N3O2 — CID 175864542

IUPAC5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid
SMILESCn1nc(C(=O)O)c(C2CCC2(F)F)n1
InChIInChI=1S/C8H9F2N3O2/c1-13-11-5(6(12-13)7(14)15)4-2-3-8(4,9)10/h4H,2-3H2,1H3,(H,14,15)
InChIKeyIZTSPGGYYQONME-UHFFFAOYSA-N
MW217.17 g/mol
LogP1.03
Rot. Bonds2

About 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid

5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid (PubChem CID 175864542) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.17 g/mol. Its IUPAC name is 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid
PubChem CID175864542
Molecular FormulaC8H9F2N3O2
Molecular Weight217.17 g/mol
Exact Mass217.07
IUPAC Name5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid
SMILESCn1nc(C(=O)O)c(C2CCC2(F)F)n1
InChIInChI=1S/C8H9F2N3O2/c1-13-11-5(6(12-13)7(14)15)4-2-3-8(4,9)10/h4H,2-3H2,1H3,(H,14,15)
InChIKeyIZTSPGGYYQONME-UHFFFAOYSA-N
XLogP1.03
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.17
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid?
The IUPAC name of 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid (CID 175864542) is 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid.
What is the SMILES notation for 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid?
The canonical SMILES for 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid is Cn1nc(C(=O)O)c(C2CCC2(F)F)n1.
What is the InChIKey of 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid?
The InChIKey is IZTSPGGYYQONME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N3O2/c1-13-11-5(6(12-13)7(14)15)4-2-3-8(4,9)10/h4H,2-3H2,1H3,(H,14,15).
What are the key properties of 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid?
5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid has a molecular weight of 217.17 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluorocyclobutyl)-2-methyltriazole-4-carboxylic acid is sourced from PubChem (CID 175864542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).