C9H12N2O2 — CID 105438703
5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid (PubChem CID 105438703) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid.
| Compound Name | 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 105438703 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nn(C)c1C1CC1 |
| InChI | InChI=1S/C9H12N2O2/c1-5-7(9(12)13)10-11(2)8(5)6-3-4-6/h6H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | USKBEJXRNQVMHT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |