5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid

C9H12N2O2 — CID 105438703

IUPAC5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid
SMILESCc1c(C(=O)O)nn(C)c1C1CC1
InChIInChI=1S/C9H12N2O2/c1-5-7(9(12)13)10-11(2)8(5)6-3-4-6/h6H,3-4H2,1-2H3,(H,12,13)
InChIKeyUSKBEJXRNQVMHT-UHFFFAOYSA-N
MW180.21 g/mol
LogP1.30
Rot. Bonds2

About 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid

5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid (PubChem CID 105438703) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid.

Molecular Properties

Compound Name5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid
PubChem CID105438703
Molecular FormulaC9H12N2O2
Molecular Weight180.21 g/mol
Exact Mass180.09
IUPAC Name5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid
SMILESCc1c(C(=O)O)nn(C)c1C1CC1
InChIInChI=1S/C9H12N2O2/c1-5-7(9(12)13)10-11(2)8(5)6-3-4-6/h6H,3-4H2,1-2H3,(H,12,13)
InChIKeyUSKBEJXRNQVMHT-UHFFFAOYSA-N
XLogP1.30
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.21
LogP ≤ 51.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid?
The IUPAC name of 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid (CID 105438703) is 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid.
What is the SMILES notation for 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid?
The canonical SMILES for 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid is Cc1c(C(=O)O)nn(C)c1C1CC1.
What is the InChIKey of 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid?
The InChIKey is USKBEJXRNQVMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-5-7(9(12)13)10-11(2)8(5)6-3-4-6/h6H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid?
5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid has a molecular weight of 180.21 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid is sourced from PubChem (CID 105438703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).