C10H17N3 — CID 83846467
5-cyclopentyl-1,4-dimethylpyrazol-3-amine (PubChem CID 83846467) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 5-cyclopentyl-1,4-dimethylpyrazol-3-amine.
| Compound Name | 5-cyclopentyl-1,4-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 83846467 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 5-cyclopentyl-1,4-dimethylpyrazol-3-amine |
| SMILES | Cc1c(N)nn(C)c1C1CCCC1 |
| InChI | InChI=1S/C10H17N3/c1-7-9(8-5-3-4-6-8)13(2)12-10(7)11/h8H,3-6H2,1-2H3,(H2,11,12) |
| InChIKey | BFSIUJLNHJQOBI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |