C5H8IN3 — CID 135342785
5-iodo-1,4-dimethylpyrazol-3-amine (PubChem CID 135342785) has the molecular formula C5H8IN3 and a molecular weight of 237.04 g/mol. Its IUPAC name is 5-iodo-1,4-dimethylpyrazol-3-amine.
| Compound Name | 5-iodo-1,4-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 135342785 |
| Molecular Formula | C5H8IN3 |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 5-iodo-1,4-dimethylpyrazol-3-amine |
| SMILES | Cc1c(N)nn(C)c1I |
| InChI | InChI=1S/C5H8IN3/c1-3-4(6)9(2)8-5(3)7/h1-2H3,(H2,7,8) |
| InChIKey | UNZGYMHBFXIPOW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|