C8H12N4 — CID 144824395
1,4-dimethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-amine (PubChem CID 144824395) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,4-dimethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-amine.
| Compound Name | 1,4-dimethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-amine |
|---|---|
| PubChem CID | 144824395 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1,4-dimethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-amine |
| SMILES | C=C/C=N\c1c(C)c(N)nn1C |
| InChI | InChI=1S/C8H12N4/c1-4-5-10-8-6(2)7(9)11-12(8)3/h4-5H,1H2,2-3H3,(H2,9,11)/b10-5- |
| InChIKey | UCWBMVIAZDFGPJ-YHYXMXQVSA-N |
| XLogP | 1.20 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|