C5H10N4 — CID 126508760
4,5-dimethylpyrazole-1,3-diamine (PubChem CID 126508760) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 4,5-dimethylpyrazole-1,3-diamine.
| Compound Name | 4,5-dimethylpyrazole-1,3-diamine |
|---|---|
| PubChem CID | 126508760 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 4,5-dimethylpyrazole-1,3-diamine |
| SMILES | Cc1c(N)nn(N)c1C |
| InChI | InChI=1S/C5H10N4/c1-3-4(2)9(7)8-5(3)6/h7H2,1-2H3,(H2,6,8) |
| InChIKey | PPEPXLDZBUIPIW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |