About 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine
3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine (PubChem CID 141134889) has the molecular formula C5H8N6
and a molecular weight of 152.16 g/mol. Its IUPAC name is 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine.
Analyze 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine?
The IUPAC name of 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine (CID 141134889) is 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine.
What is the SMILES notation for 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine?
The canonical SMILES for 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine is Cc1nn(N)c2c(N)ncn12.
What is the InChIKey of 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine?
The InChIKey is QPPYVXHUTOINDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6/c1-3-9-11(7)5-4(6)8-2-10(3)5/h2H,6-7H2,1H3.
What are the key properties of 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine?
3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine has a molecular weight of 152.16 g/mol, XLogP of -0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylimidazo[5,1-c][1,2,4]triazole-1,7-diamine is sourced from PubChem (CID 141134889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).