C7H6BrN3 — CID 83867437
5-bromoimidazo[1,5-a]pyridin-1-amine (PubChem CID 83867437) has the molecular formula C7H6BrN3 and a molecular weight of 212.05 g/mol. Its IUPAC name is 5-bromoimidazo[1,5-a]pyridin-1-amine.
| Compound Name | 5-bromoimidazo[1,5-a]pyridin-1-amine |
|---|---|
| PubChem CID | 83867437 |
| Molecular Formula | C7H6BrN3 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | 5-bromoimidazo[1,5-a]pyridin-1-amine |
| SMILES | Nc1ncn2c(Br)cccc12 |
| InChI | InChI=1S/C7H6BrN3/c8-6-3-1-2-5-7(9)10-4-11(5)6/h1-4H,9H2 |
| InChIKey | RMDSQUXKSCFNCE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|