C9H7BrN2O — CID 83898374
2-(1-bromoimidazo[1,5-a]pyridin-5-yl)acetaldehyde (PubChem CID 83898374) has the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. Its IUPAC name is 2-(1-bromoimidazo[1,5-a]pyridin-5-yl)acetaldehyde.
| Compound Name | 2-(1-bromoimidazo[1,5-a]pyridin-5-yl)acetaldehyde |
|---|---|
| PubChem CID | 83898374 |
| Molecular Formula | C9H7BrN2O |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 2-(1-bromoimidazo[1,5-a]pyridin-5-yl)acetaldehyde |
| SMILES | O=CCc1cccc2c(Br)ncn12 |
| InChI | InChI=1S/C9H7BrN2O/c10-9-8-3-1-2-7(4-5-13)12(8)6-11-9/h1-3,5-6H,4H2 |
| InChIKey | SEKRRAFJCZUQMW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|