C11H15N3 — CID 83877257
3-(1-methylimidazo[1,5-a]pyridin-5-yl)propan-1-amine (PubChem CID 83877257) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(1-methylimidazo[1,5-a]pyridin-5-yl)propan-1-amine.
| Compound Name | 3-(1-methylimidazo[1,5-a]pyridin-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 83877257 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-(1-methylimidazo[1,5-a]pyridin-5-yl)propan-1-amine |
| SMILES | Cc1ncn2c(CCCN)cccc12 |
| InChI | InChI=1S/C11H15N3/c1-9-11-6-2-4-10(5-3-7-12)14(11)8-13-9/h2,4,6,8H,3,5,7,12H2,1H3 |
| InChIKey | NBEXUWYWBUPANF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |