C12H15ClN2 — CID 116993714
3-(1-chloro-2-methylindolizin-3-yl)propan-1-amine (PubChem CID 116993714) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 3-(1-chloro-2-methylindolizin-3-yl)propan-1-amine.
| Compound Name | 3-(1-chloro-2-methylindolizin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 116993714 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-(1-chloro-2-methylindolizin-3-yl)propan-1-amine |
| SMILES | Cc1c(Cl)c2ccccn2c1CCCN |
| InChI | InChI=1S/C12H15ClN2/c1-9-10(6-4-7-14)15-8-3-2-5-11(15)12(9)13/h2-3,5,8H,4,6-7,14H2,1H3 |
| InChIKey | JSDJWJGPCPMGIK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |