C15H19ClN2 — CID 116993733
1-chloro-2-methyl-3-(piperidin-2-ylmethyl)indolizine (PubChem CID 116993733) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 1-chloro-2-methyl-3-(piperidin-2-ylmethyl)indolizine.
| Compound Name | 1-chloro-2-methyl-3-(piperidin-2-ylmethyl)indolizine |
|---|---|
| PubChem CID | 116993733 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-chloro-2-methyl-3-(piperidin-2-ylmethyl)indolizine |
| SMILES | Cc1c(Cl)c2ccccn2c1CC1CCCCN1 |
| InChI | InChI=1S/C15H19ClN2/c1-11-14(10-12-6-2-4-8-17-12)18-9-5-3-7-13(18)15(11)16/h3,5,7,9,12,17H,2,4,6,8,10H2,1H3 |
| InChIKey | UIFIUAOSNAEQNQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 16.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |