C13H15Cl2N3 — CID 117254735
1,8-dichloro-3-(piperidin-2-ylmethyl)imidazo[1,5-a]pyridine (PubChem CID 117254735) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is 1,8-dichloro-3-(piperidin-2-ylmethyl)imidazo[1,5-a]pyridine.
| Compound Name | 1,8-dichloro-3-(piperidin-2-ylmethyl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117254735 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1,8-dichloro-3-(piperidin-2-ylmethyl)imidazo[1,5-a]pyridine |
| SMILES | Clc1cccn2c(CC3CCCCN3)nc(Cl)c12 |
| InChI | InChI=1S/C13H15Cl2N3/c14-10-5-3-7-18-11(17-13(15)12(10)18)8-9-4-1-2-6-16-9/h3,5,7,9,16H,1-2,4,6,8H2 |
| InChIKey | DKAMCPXWGVMJBP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |