C15H19ClN2 — CID 117411537
3-chloro-1-methyl-4-(piperidin-2-ylmethyl)indole (PubChem CID 117411537) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 3-chloro-1-methyl-4-(piperidin-2-ylmethyl)indole.
| Compound Name | 3-chloro-1-methyl-4-(piperidin-2-ylmethyl)indole |
|---|---|
| PubChem CID | 117411537 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-chloro-1-methyl-4-(piperidin-2-ylmethyl)indole |
| SMILES | Cn1cc(Cl)c2c(CC3CCCCN3)cccc21 |
| InChI | InChI=1S/C15H19ClN2/c1-18-10-13(16)15-11(5-4-7-14(15)18)9-12-6-2-3-8-17-12/h4-5,7,10,12,17H,2-3,6,8-9H2,1H3 |
| InChIKey | WATFYXJPPJUDTP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|