C11H14N2O — CID 83877468
3-(3-methyl-1,2-benzoxazol-7-yl)propan-1-amine (PubChem CID 83877468) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-(3-methyl-1,2-benzoxazol-7-yl)propan-1-amine.
| Compound Name | 3-(3-methyl-1,2-benzoxazol-7-yl)propan-1-amine |
|---|---|
| PubChem CID | 83877468 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-(3-methyl-1,2-benzoxazol-7-yl)propan-1-amine |
| SMILES | Cc1noc2c(CCCN)cccc12 |
| InChI | InChI=1S/C11H14N2O/c1-8-10-6-2-4-9(5-3-7-12)11(10)14-13-8/h2,4,6H,3,5,7,12H2,1H3 |
| InChIKey | JWMKAGFWWOVCAZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |