C8H5ClN2O — CID 83875633
1-chloroimidazo[1,5-a]pyridine-5-carbaldehyde (PubChem CID 83875633) has the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. Its IUPAC name is 1-chloroimidazo[1,5-a]pyridine-5-carbaldehyde.
| Compound Name | 1-chloroimidazo[1,5-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 83875633 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 1-chloroimidazo[1,5-a]pyridine-5-carbaldehyde |
| SMILES | O=Cc1cccc2c(Cl)ncn12 |
| InChI | InChI=1S/C8H5ClN2O/c9-8-7-3-1-2-6(4-12)11(7)5-10-8/h1-5H |
| InChIKey | OVYHZOCOCZIMBV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|