C11H13ClN2O2 — CID 171568575
4-chloro-2-methylpyrrolo[1,2-b]pyridazine-7-carbaldehyde;methoxymethane (PubChem CID 171568575) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 4-chloro-2-methylpyrrolo[1,2-b]pyridazine-7-carbaldehyde;methoxymethane.
| Compound Name | 4-chloro-2-methylpyrrolo[1,2-b]pyridazine-7-carbaldehyde;methoxymethane |
|---|---|
| PubChem CID | 171568575 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-chloro-2-methylpyrrolo[1,2-b]pyridazine-7-carbaldehyde;methoxymethane |
| SMILES | COC.Cc1cc(Cl)c2ccc(C=O)n2n1 |
| InChI | InChI=1S/C9H7ClN2O.C2H6O/c1-6-4-8(10)9-3-2-7(5-13)12(9)11-6;1-3-2/h2-5H,1H3;1-2H3 |
| InChIKey | MTUQTKKQHJYUKB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|