C8H7N3O — CID 10374726
3-methyltriazolo[1,5-a]pyridine-7-carbaldehyde (PubChem CID 10374726) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-methyltriazolo[1,5-a]pyridine-7-carbaldehyde.
| Compound Name | 3-methyltriazolo[1,5-a]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 10374726 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3-methyltriazolo[1,5-a]pyridine-7-carbaldehyde |
| SMILES | Cc1nnn2c(C=O)cccc12 |
| InChI | InChI=1S/C8H7N3O/c1-6-8-4-2-3-7(5-12)11(8)10-9-6/h2-5H,1H3 |
| InChIKey | CSZRMKKLQNBTIG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|