C7H6BrN3 — CID 83821057
3-bromo-7-methyltriazolo[1,5-a]pyridine (PubChem CID 83821057) has the molecular formula C7H6BrN3 and a molecular weight of 212.05 g/mol. Its IUPAC name is 3-bromo-7-methyltriazolo[1,5-a]pyridine.
| Compound Name | 3-bromo-7-methyltriazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83821057 |
| Molecular Formula | C7H6BrN3 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | 3-bromo-7-methyltriazolo[1,5-a]pyridine |
| SMILES | Cc1cccc2c(Br)nnn12 |
| InChI | InChI=1S/C7H6BrN3/c1-5-3-2-4-6-7(8)9-10-11(5)6/h2-4H,1H3 |
| InChIKey | XNROPQOUIZPNLY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |