C14H14N6 — CID 135447735
3-methyl-7-[(1E,3E)-4-(5-methyl-2H-triazol-4-yl)buta-1,3-dienyl]triazolo[1,5-a]pyridine (PubChem CID 135447735) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is 3-methyl-7-[(1E,3E)-4-(5-methyl-2H-triazol-4-yl)buta-1,3-dienyl]triazolo[1,5-a]pyridine.
| Compound Name | 3-methyl-7-[(1E,3E)-4-(5-methyl-2H-triazol-4-yl)buta-1,3-dienyl]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 135447735 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-methyl-7-[(1E,3E)-4-(5-methyl-2H-triazol-4-yl)buta-1,3-dienyl]triazolo[1,5-a]pyridine |
| SMILES | Cc1n[nH]nc1/C=C/C=C/c1cccc2c(C)nnn12 |
| InChI | InChI=1S/C14H14N6/c1-10-13(17-18-15-10)8-4-3-6-12-7-5-9-14-11(2)16-19-20(12)14/h3-9H,1-2H3,(H,15,17,18)/b6-3+,8-4+ |
| InChIKey | BOPDOGZECAEWSK-PHQNLGIASA-N |
| XLogP | 2.19 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|